C12H18N6S2 — CID 80980190
[2-tert-butyl-6-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]pyrimidin-4-yl]hydrazine (PubChem CID 80980190) has the molecular formula C12H18N6S2 and a molecular weight of 310.45 g/mol. Its IUPAC name is [2-tert-butyl-6-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]pyrimidin-4-yl]hydrazine.
| Compound Name | [2-tert-butyl-6-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 80980190 |
| Molecular Formula | C12H18N6S2 |
| Molecular Weight | 310.45 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | [2-tert-butyl-6-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]pyrimidin-4-yl]hydrazine |
| SMILES | CCc1nsc(Sc2cc(NN)nc(C(C)(C)C)n2)n1 |
| InChI | InChI=1S/C12H18N6S2/c1-5-7-15-11(20-18-7)19-9-6-8(17-13)14-10(16-9)12(2,3)4/h6H,5,13H2,1-4H3,(H,14,16,17) |
| InChIKey | MCBGZASUIZYRJZ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 89.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.45 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|