C13H16BrN5S — CID 80980403
[6-[(3-bromo-2-pyridinyl)sulfanyl]-2-tert-butylpyrimidin-4-yl]hydrazine (PubChem CID 80980403) has the molecular formula C13H16BrN5S and a molecular weight of 354.28 g/mol. Its IUPAC name is [6-[(3-bromo-2-pyridinyl)sulfanyl]-2-tert-butylpyrimidin-4-yl]hydrazine.
| Compound Name | [6-[(3-bromo-2-pyridinyl)sulfanyl]-2-tert-butylpyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 80980403 |
| Molecular Formula | C13H16BrN5S |
| Molecular Weight | 354.28 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | [6-[(3-bromo-2-pyridinyl)sulfanyl]-2-tert-butylpyrimidin-4-yl]hydrazine |
| SMILES | CC(C)(C)c1nc(NN)cc(Sc2ncccc2Br)n1 |
| InChI | InChI=1S/C13H16BrN5S/c1-13(2,3)12-17-9(19-15)7-10(18-12)20-11-8(14)5-4-6-16-11/h4-7H,15H2,1-3H3,(H,17,18,19) |
| InChIKey | SADAYHJPITWGRJ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.28 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|