C12H19N7S2 — CID 80972938
5-(2-tert-butyl-6-hydrazinylpyrimidin-4-yl)sulfanyl-N,N-dimethyl-1,3,4-thiadiazol-2-amine (PubChem CID 80972938) has the molecular formula C12H19N7S2 and a molecular weight of 325.47 g/mol. Its IUPAC name is 5-(2-tert-butyl-6-hydrazinylpyrimidin-4-yl)sulfanyl-N,N-dimethyl-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-(2-tert-butyl-6-hydrazinylpyrimidin-4-yl)sulfanyl-N,N-dimethyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 80972938 |
| Molecular Formula | C12H19N7S2 |
| Molecular Weight | 325.47 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 5-(2-tert-butyl-6-hydrazinylpyrimidin-4-yl)sulfanyl-N,N-dimethyl-1,3,4-thiadiazol-2-amine |
| SMILES | CN(C)c1nnc(Sc2cc(NN)nc(C(C)(C)C)n2)s1 |
| InChI | InChI=1S/C12H19N7S2/c1-12(2,3)9-14-7(16-13)6-8(15-9)20-11-18-17-10(21-11)19(4)5/h6H,13H2,1-5H3,(H,14,15,16) |
| InChIKey | MRSSFWBPMLJOIO-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 92.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.47 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|