C8H10N6S2 — CID 80922686
[2-methyl-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]pyrimidin-4-yl]hydrazine (PubChem CID 80922686) has the molecular formula C8H10N6S2 and a molecular weight of 254.34 g/mol. Its IUPAC name is [2-methyl-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]pyrimidin-4-yl]hydrazine.
| Compound Name | [2-methyl-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 80922686 |
| Molecular Formula | C8H10N6S2 |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | [2-methyl-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]pyrimidin-4-yl]hydrazine |
| SMILES | Cc1nc(NN)cc(Sc2nnc(C)s2)n1 |
| InChI | InChI=1S/C8H10N6S2/c1-4-10-6(12-9)3-7(11-4)16-8-14-13-5(2)15-8/h3H,9H2,1-2H3,(H,10,11,12) |
| InChIKey | VNSSFUZMXGZCEG-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 89.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|