C10H10N6S2 — CID 103333777
2-hydrazinyl-N-(1,3-thiazol-4-ylmethyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 103333777) has the molecular formula C10H10N6S2 and a molecular weight of 278.37 g/mol. Its IUPAC name is 2-hydrazinyl-N-(1,3-thiazol-4-ylmethyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-hydrazinyl-N-(1,3-thiazol-4-ylmethyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 103333777 |
| Molecular Formula | C10H10N6S2 |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 2-hydrazinyl-N-(1,3-thiazol-4-ylmethyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | NNc1nc(NCc2cscn2)c2ccsc2n1 |
| InChI | InChI=1S/C10H10N6S2/c11-16-10-14-8(7-1-2-18-9(7)15-10)12-3-6-4-17-5-13-6/h1-2,4-5H,3,11H2,(H2,12,14,15,16) |
| InChIKey | FRPQDAAUINAFKE-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|