C12H14N6OS — CID 106379043
N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-hydrazinylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 106379043) has the molecular formula C12H14N6OS and a molecular weight of 290.35 g/mol. Its IUPAC name is N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-hydrazinylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-hydrazinylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 106379043 |
| Molecular Formula | C12H14N6OS |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-hydrazinylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1nc(CNc2nc(NN)nc3sccc23)oc1C |
| InChI | InChI=1S/C12H14N6OS/c1-6-7(2)19-9(15-6)5-14-10-8-3-4-20-11(8)17-12(16-10)18-13/h3-4H,5,13H2,1-2H3,(H2,14,16,17,18) |
| InChIKey | XJFDHUCDIGZZNX-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 101.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|