C11H12N6OS — CID 103333206
2-hydrazinyl-N-[(3-methyl-1,2-oxazol-5-yl)methyl]thieno[2,3-d]pyrimidin-4-amine (PubChem CID 103333206) has the molecular formula C11H12N6OS and a molecular weight of 276.32 g/mol. Its IUPAC name is 2-hydrazinyl-N-[(3-methyl-1,2-oxazol-5-yl)methyl]thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-hydrazinyl-N-[(3-methyl-1,2-oxazol-5-yl)methyl]thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 103333206 |
| Molecular Formula | C11H12N6OS |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 2-hydrazinyl-N-[(3-methyl-1,2-oxazol-5-yl)methyl]thieno[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1cc(CNc2nc(NN)nc3sccc23)on1 |
| InChI | InChI=1S/C11H12N6OS/c1-6-4-7(18-17-6)5-13-9-8-2-3-19-10(8)15-11(14-9)16-12/h2-4H,5,12H2,1H3,(H2,13,14,15,16) |
| InChIKey | HNYDEUNDFVBQKH-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 101.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|