C10H8N4S2 — CID 62251574
(2-thiophen-3-ylthieno[2,3-d]pyrimidin-4-yl)hydrazine (PubChem CID 62251574) has the molecular formula C10H8N4S2 and a molecular weight of 248.34 g/mol. Its IUPAC name is (2-thiophen-3-ylthieno[2,3-d]pyrimidin-4-yl)hydrazine.
| Compound Name | (2-thiophen-3-ylthieno[2,3-d]pyrimidin-4-yl)hydrazine |
|---|---|
| PubChem CID | 62251574 |
| Molecular Formula | C10H8N4S2 |
| Molecular Weight | 248.34 g/mol |
| Exact Mass | 248.02 |
| IUPAC Name | (2-thiophen-3-ylthieno[2,3-d]pyrimidin-4-yl)hydrazine |
| SMILES | NNc1nc(-c2ccsc2)nc2sccc12 |
| InChI | InChI=1S/C10H8N4S2/c11-14-9-7-2-4-16-10(7)13-8(12-9)6-1-3-15-5-6/h1-5H,11H2,(H,12,13,14) |
| InChIKey | OHXDKWJBZJJHQI-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.34 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|