C12H8ClFN4S — CID 55153376
[2-(2-chloro-4-fluorophenyl)thieno[2,3-d]pyrimidin-4-yl]hydrazine (PubChem CID 55153376) has the molecular formula C12H8ClFN4S and a molecular weight of 294.74 g/mol. Its IUPAC name is [2-(2-chloro-4-fluorophenyl)thieno[2,3-d]pyrimidin-4-yl]hydrazine.
| Compound Name | [2-(2-chloro-4-fluorophenyl)thieno[2,3-d]pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 55153376 |
| Molecular Formula | C12H8ClFN4S |
| Molecular Weight | 294.74 g/mol |
| Exact Mass | 294.01 |
| IUPAC Name | [2-(2-chloro-4-fluorophenyl)thieno[2,3-d]pyrimidin-4-yl]hydrazine |
| SMILES | NNc1nc(-c2ccc(F)cc2Cl)nc2sccc12 |
| InChI | InChI=1S/C12H8ClFN4S/c13-9-5-6(14)1-2-7(9)10-16-11(18-15)8-3-4-19-12(8)17-10/h1-5H,15H2,(H,16,17,18) |
| InChIKey | PGLUIPGYNRCMPL-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.74 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|