About [2-(2-chloro-4-fluorophenyl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-yl]hydrazine
[2-(2-chloro-4-fluorophenyl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-yl]hydrazine (PubChem CID 62946048) has the molecular formula C14H12ClFN4S
and a molecular weight of 322.80 g/mol. Its IUPAC name is [2-(2-chloro-4-fluorophenyl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-yl]hydrazine.
Molecular Properties
| Compound Name | [2-(2-chloro-4-fluorophenyl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-yl]hydrazine |
| PubChem CID | 62946048 |
| Molecular Formula | C14H12ClFN4S |
| Molecular Weight | 322.80 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | [2-(2-chloro-4-fluorophenyl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-yl]hydrazine |
| SMILES | Cc1sc2nc(-c3ccc(F)cc3Cl)nc(NN)c2c1C |
| InChI | InChI=1S/C14H12ClFN4S/c1-6-7(2)21-14-11(6)13(20-17)18-12(19-14)9-4-3-8(16)5-10(9)15/h3-5H,17H2,1-2H3,(H,18,19,20) |
| InChIKey | TTWRDWRMUOUJGV-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.80 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-(2-chloro-4-fluorophenyl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-chloro-4-fluorophenyl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-yl]hydrazine?
The IUPAC name of [2-(2-chloro-4-fluorophenyl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-yl]hydrazine (CID 62946048) is [2-(2-chloro-4-fluorophenyl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-yl]hydrazine.
What is the SMILES notation for [2-(2-chloro-4-fluorophenyl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-yl]hydrazine?
The canonical SMILES for [2-(2-chloro-4-fluorophenyl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-yl]hydrazine is Cc1sc2nc(-c3ccc(F)cc3Cl)nc(NN)c2c1C.
What is the InChIKey of [2-(2-chloro-4-fluorophenyl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-yl]hydrazine?
The InChIKey is TTWRDWRMUOUJGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12ClFN4S/c1-6-7(2)21-14-11(6)13(20-17)18-12(19-14)9-4-3-8(16)5-10(9)15/h3-5H,17H2,1-2H3,(H,18,19,20).
What are the key properties of [2-(2-chloro-4-fluorophenyl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-yl]hydrazine?
[2-(2-chloro-4-fluorophenyl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-yl]hydrazine has a molecular weight of 322.80 g/mol, XLogP of 4.05, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-chloro-4-fluorophenyl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-yl]hydrazine is sourced from PubChem (CID 62946048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).