C14H12BrFN4S — CID 107281495
[2-(2-bromo-4-fluorophenyl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-yl]hydrazine (PubChem CID 107281495) has the molecular formula C14H12BrFN4S and a molecular weight of 367.25 g/mol. Its IUPAC name is [2-(2-bromo-4-fluorophenyl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-yl]hydrazine.
| Compound Name | [2-(2-bromo-4-fluorophenyl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 107281495 |
| Molecular Formula | C14H12BrFN4S |
| Molecular Weight | 367.25 g/mol |
| Exact Mass | 366.00 |
| IUPAC Name | [2-(2-bromo-4-fluorophenyl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-yl]hydrazine |
| SMILES | Cc1sc2nc(-c3ccc(F)cc3Br)nc(NN)c2c1C |
| InChI | InChI=1S/C14H12BrFN4S/c1-6-7(2)21-14-11(6)13(20-17)18-12(19-14)9-4-3-8(16)5-10(9)15/h3-5H,17H2,1-2H3,(H,18,19,20) |
| InChIKey | XVNQZQKLNORKSY-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.25 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|