C9H3Cl3FN3 — CID 115504981
2,4-dichloro-6-(2-chloro-4-fluorophenyl)-1,3,5-triazine (PubChem CID 115504981) has the molecular formula C9H3Cl3FN3 and a molecular weight of 278.50 g/mol. Its IUPAC name is 2,4-dichloro-6-(2-chloro-4-fluorophenyl)-1,3,5-triazine.
| Compound Name | 2,4-dichloro-6-(2-chloro-4-fluorophenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 115504981 |
| Molecular Formula | C9H3Cl3FN3 |
| Molecular Weight | 278.50 g/mol |
| Exact Mass | 276.94 |
| IUPAC Name | 2,4-dichloro-6-(2-chloro-4-fluorophenyl)-1,3,5-triazine |
| SMILES | Fc1ccc(-c2nc(Cl)nc(Cl)n2)c(Cl)c1 |
| InChI | InChI=1S/C9H3Cl3FN3/c10-6-3-4(13)1-2-5(6)7-14-8(11)16-9(12)15-7/h1-3H |
| InChIKey | FJPIRCCSIGXDNL-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.50 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |