C14H16ClFN4 — CID 62944421
[6-tert-butyl-2-(2-chloro-4-fluorophenyl)pyrimidin-4-yl]hydrazine (PubChem CID 62944421) has the molecular formula C14H16ClFN4 and a molecular weight of 294.76 g/mol. Its IUPAC name is [6-tert-butyl-2-(2-chloro-4-fluorophenyl)pyrimidin-4-yl]hydrazine.
| Compound Name | [6-tert-butyl-2-(2-chloro-4-fluorophenyl)pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 62944421 |
| Molecular Formula | C14H16ClFN4 |
| Molecular Weight | 294.76 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | [6-tert-butyl-2-(2-chloro-4-fluorophenyl)pyrimidin-4-yl]hydrazine |
| SMILES | CC(C)(C)c1cc(NN)nc(-c2ccc(F)cc2Cl)n1 |
| InChI | InChI=1S/C14H16ClFN4/c1-14(2,3)11-7-12(20-17)19-13(18-11)9-5-4-8(16)6-10(9)15/h4-7H,17H2,1-3H3,(H,18,19,20) |
| InChIKey | ZLHJBGFYBVWSCD-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.76 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|