C15H13ClFN3S — CID 63487110
2-(5-chloro-2-fluorophenyl)-N-propylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 63487110) has the molecular formula C15H13ClFN3S and a molecular weight of 321.81 g/mol. Its IUPAC name is 2-(5-chloro-2-fluorophenyl)-N-propylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-(5-chloro-2-fluorophenyl)-N-propylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 63487110 |
| Molecular Formula | C15H13ClFN3S |
| Molecular Weight | 321.81 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | 2-(5-chloro-2-fluorophenyl)-N-propylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCCNc1nc(-c2cc(Cl)ccc2F)nc2sccc12 |
| InChI | InChI=1S/C15H13ClFN3S/c1-2-6-18-13-10-5-7-21-15(10)20-14(19-13)11-8-9(16)3-4-12(11)17/h3-5,7-8H,2,6H2,1H3,(H,18,19,20) |
| InChIKey | CTHIRFJIUQTNIN-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.81 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |