C16H16ClN3S — CID 79808207
7-chloro-2-(4-methylthiophen-3-yl)-N-propylquinazolin-4-amine (PubChem CID 79808207) has the molecular formula C16H16ClN3S and a molecular weight of 317.85 g/mol. Its IUPAC name is 7-chloro-2-(4-methylthiophen-3-yl)-N-propylquinazolin-4-amine.
| Compound Name | 7-chloro-2-(4-methylthiophen-3-yl)-N-propylquinazolin-4-amine |
|---|---|
| PubChem CID | 79808207 |
| Molecular Formula | C16H16ClN3S |
| Molecular Weight | 317.85 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 7-chloro-2-(4-methylthiophen-3-yl)-N-propylquinazolin-4-amine |
| SMILES | CCCNc1nc(-c2cscc2C)nc2cc(Cl)ccc12 |
| InChI | InChI=1S/C16H16ClN3S/c1-3-6-18-15-12-5-4-11(17)7-14(12)19-16(20-15)13-9-21-8-10(13)2/h4-5,7-9H,3,6H2,1-2H3,(H,18,19,20) |
| InChIKey | XXGWZQKTHTYMAK-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.85 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |