C14H10Cl3N3S — CID 107966565
6-chloro-2-(2,5-dichlorothiophen-3-yl)-N-ethylquinazolin-4-amine (PubChem CID 107966565) has the molecular formula C14H10Cl3N3S and a molecular weight of 358.68 g/mol. Its IUPAC name is 6-chloro-2-(2,5-dichlorothiophen-3-yl)-N-ethylquinazolin-4-amine.
| Compound Name | 6-chloro-2-(2,5-dichlorothiophen-3-yl)-N-ethylquinazolin-4-amine |
|---|---|
| PubChem CID | 107966565 |
| Molecular Formula | C14H10Cl3N3S |
| Molecular Weight | 358.68 g/mol |
| Exact Mass | 356.97 |
| IUPAC Name | 6-chloro-2-(2,5-dichlorothiophen-3-yl)-N-ethylquinazolin-4-amine |
| SMILES | CCNc1nc(-c2cc(Cl)sc2Cl)nc2ccc(Cl)cc12 |
| InChI | InChI=1S/C14H10Cl3N3S/c1-2-18-13-8-5-7(15)3-4-10(8)19-14(20-13)9-6-11(16)21-12(9)17/h3-6H,2H2,1H3,(H,18,19,20) |
| InChIKey | HYGLKWXMDVPFSL-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.68 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |