C17H17ClN4O — CID 24860253
N'-[6-chloro-2-(2-methoxyphenyl)quinazolin-4-yl]ethane-1,2-diamine (PubChem CID 24860253) has the molecular formula C17H17ClN4O and a molecular weight of 328.80 g/mol. Its IUPAC name is N'-[6-chloro-2-(2-methoxyphenyl)quinazolin-4-yl]ethane-1,2-diamine.
| Compound Name | N'-[6-chloro-2-(2-methoxyphenyl)quinazolin-4-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 24860253 |
| Molecular Formula | C17H17ClN4O |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | N'-[6-chloro-2-(2-methoxyphenyl)quinazolin-4-yl]ethane-1,2-diamine |
| SMILES | COc1ccccc1-c1nc(NCCN)c2cc(Cl)ccc2n1 |
| InChI | InChI=1S/C17H17ClN4O/c1-23-15-5-3-2-4-12(15)17-21-14-7-6-11(18)10-13(14)16(22-17)20-9-8-19/h2-7,10H,8-9,19H2,1H3,(H,20,21,22) |
| InChIKey | LJGVWRSRZRHUAW-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |