C11H10N6S — CID 115531208
[2-(2-methylpyrimidin-4-yl)thieno[2,3-d]pyrimidin-4-yl]hydrazine (PubChem CID 115531208) has the molecular formula C11H10N6S and a molecular weight of 258.31 g/mol. Its IUPAC name is [2-(2-methylpyrimidin-4-yl)thieno[2,3-d]pyrimidin-4-yl]hydrazine.
| Compound Name | [2-(2-methylpyrimidin-4-yl)thieno[2,3-d]pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 115531208 |
| Molecular Formula | C11H10N6S |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | [2-(2-methylpyrimidin-4-yl)thieno[2,3-d]pyrimidin-4-yl]hydrazine |
| SMILES | Cc1nccc(-c2nc(NN)c3ccsc3n2)n1 |
| InChI | InChI=1S/C11H10N6S/c1-6-13-4-2-8(14-6)10-15-9(17-12)7-3-5-18-11(7)16-10/h2-5H,12H2,1H3,(H,15,16,17) |
| InChIKey | HSIUTKAPVNYVJC-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 89.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|