C14H13BrN4OS — CID 63216895
[2-[(4-bromo-2-methylphenoxy)methyl]thieno[2,3-d]pyrimidin-4-yl]hydrazine (PubChem CID 63216895) has the molecular formula C14H13BrN4OS and a molecular weight of 365.26 g/mol. Its IUPAC name is [2-[(4-bromo-2-methylphenoxy)methyl]thieno[2,3-d]pyrimidin-4-yl]hydrazine.
| Compound Name | [2-[(4-bromo-2-methylphenoxy)methyl]thieno[2,3-d]pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 63216895 |
| Molecular Formula | C14H13BrN4OS |
| Molecular Weight | 365.26 g/mol |
| Exact Mass | 364.00 |
| IUPAC Name | [2-[(4-bromo-2-methylphenoxy)methyl]thieno[2,3-d]pyrimidin-4-yl]hydrazine |
| SMILES | Cc1cc(Br)ccc1OCc1nc(NN)c2ccsc2n1 |
| InChI | InChI=1S/C14H13BrN4OS/c1-8-6-9(15)2-3-11(8)20-7-12-17-13(19-16)10-4-5-21-14(10)18-12/h2-6H,7,16H2,1H3,(H,17,18,19) |
| InChIKey | QSBHXUOUMBNOAG-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.26 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|