C13H10Cl2N4OS — CID 62246555
[2-[(3,4-dichlorophenoxy)methyl]thieno[2,3-d]pyrimidin-4-yl]hydrazine (PubChem CID 62246555) has the molecular formula C13H10Cl2N4OS and a molecular weight of 341.22 g/mol. Its IUPAC name is [2-[(3,4-dichlorophenoxy)methyl]thieno[2,3-d]pyrimidin-4-yl]hydrazine.
| Compound Name | [2-[(3,4-dichlorophenoxy)methyl]thieno[2,3-d]pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 62246555 |
| Molecular Formula | C13H10Cl2N4OS |
| Molecular Weight | 341.22 g/mol |
| Exact Mass | 340.00 |
| IUPAC Name | [2-[(3,4-dichlorophenoxy)methyl]thieno[2,3-d]pyrimidin-4-yl]hydrazine |
| SMILES | NNc1nc(COc2ccc(Cl)c(Cl)c2)nc2sccc12 |
| InChI | InChI=1S/C13H10Cl2N4OS/c14-9-2-1-7(5-10(9)15)20-6-11-17-12(19-16)8-3-4-21-13(8)18-11/h1-5H,6,16H2,(H,17,18,19) |
| InChIKey | XXEQFGTUICDFTH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.22 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|