C10H5ClN2S2 — CID 130535740
4-chloro-2-thiophen-3-ylthieno[3,2-d]pyrimidine (PubChem CID 130535740) has the molecular formula C10H5ClN2S2 and a molecular weight of 252.75 g/mol. Its IUPAC name is 4-chloro-2-thiophen-3-ylthieno[3,2-d]pyrimidine.
| Compound Name | 4-chloro-2-thiophen-3-ylthieno[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 130535740 |
| Molecular Formula | C10H5ClN2S2 |
| Molecular Weight | 252.75 g/mol |
| Exact Mass | 251.96 |
| IUPAC Name | 4-chloro-2-thiophen-3-ylthieno[3,2-d]pyrimidine |
| SMILES | Clc1nc(-c2ccsc2)nc2ccsc12 |
| InChI | InChI=1S/C10H5ClN2S2/c11-9-8-7(2-4-15-8)12-10(13-9)6-1-3-14-5-6/h1-5H |
| InChIKey | HNCDNCXCVOJVKA-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.75 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |