C18H10S4 — CID 102164796
4,5-di(thiophen-3-yl)thieno[3,2-g][1]benzothiole (PubChem CID 102164796) has the molecular formula C18H10S4 and a molecular weight of 354.55 g/mol. Its IUPAC name is 4,5-di(thiophen-3-yl)thieno[3,2-g][1]benzothiole.
| Compound Name | 4,5-di(thiophen-3-yl)thieno[3,2-g][1]benzothiole |
|---|---|
| PubChem CID | 102164796 |
| Molecular Formula | C18H10S4 |
| Molecular Weight | 354.55 g/mol |
| Exact Mass | 353.97 |
| IUPAC Name | 4,5-di(thiophen-3-yl)thieno[3,2-g][1]benzothiole |
| SMILES | c1cc(-c2c(-c3ccsc3)c3ccsc3c3sccc23)cs1 |
| InChI | InChI=1S/C18H10S4/c1-5-19-9-11(1)15-13-3-7-21-17(13)18-14(4-8-22-18)16(15)12-2-6-20-10-12/h1-10H |
| InChIKey | PAOUGEIQUJUYDL-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.55 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |