C26H28S2 — CID 169050308
3-(2,6-ditert-butyl-5-thiophen-3-ylnaphthalen-1-yl)thiophene (PubChem CID 169050308) has the molecular formula C26H28S2 and a molecular weight of 404.64 g/mol. Its IUPAC name is 3-(2,6-ditert-butyl-5-thiophen-3-ylnaphthalen-1-yl)thiophene.
| Compound Name | 3-(2,6-ditert-butyl-5-thiophen-3-ylnaphthalen-1-yl)thiophene |
|---|---|
| PubChem CID | 169050308 |
| Molecular Formula | C26H28S2 |
| Molecular Weight | 404.64 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | 3-(2,6-ditert-butyl-5-thiophen-3-ylnaphthalen-1-yl)thiophene |
| SMILES | CC(C)(C)c1ccc2c(-c3ccsc3)c(C(C)(C)C)ccc2c1-c1ccsc1 |
| InChI | InChI=1S/C26H28S2/c1-25(2,3)21-9-7-20-19(23(21)17-11-13-27-15-17)8-10-22(26(4,5)6)24(20)18-12-14-28-16-18/h7-16H,1-6H3 |
| InChIKey | MBVOICVUTXPWPM-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.64 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |