C14H15N5S2 — CID 103333485
2-hydrazinyl-N-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 103333485) has the molecular formula C14H15N5S2 and a molecular weight of 317.44 g/mol. Its IUPAC name is 2-hydrazinyl-N-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-hydrazinyl-N-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 103333485 |
| Molecular Formula | C14H15N5S2 |
| Molecular Weight | 317.44 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 2-hydrazinyl-N-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | NNc1nc(NC2CCCc3sccc32)c2ccsc2n1 |
| InChI | InChI=1S/C14H15N5S2/c15-19-14-17-12(9-5-7-21-13(9)18-14)16-10-2-1-3-11-8(10)4-6-20-11/h4-7,10H,1-3,15H2,(H2,16,17,18,19) |
| InChIKey | GOIZEPNTSLPBCO-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.44 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|