C15H21N5S — CID 81007227
2-ethyl-6-hydrazinyl-5-methyl-N-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)pyrimidin-4-amine (PubChem CID 81007227) has the molecular formula C15H21N5S and a molecular weight of 303.44 g/mol. Its IUPAC name is 2-ethyl-6-hydrazinyl-5-methyl-N-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)pyrimidin-4-amine.
| Compound Name | 2-ethyl-6-hydrazinyl-5-methyl-N-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 81007227 |
| Molecular Formula | C15H21N5S |
| Molecular Weight | 303.44 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 2-ethyl-6-hydrazinyl-5-methyl-N-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)pyrimidin-4-amine |
| SMILES | CCc1nc(NN)c(C)c(NC2CCCc3sccc32)n1 |
| InChI | InChI=1S/C15H21N5S/c1-3-13-18-14(9(2)15(19-13)20-16)17-11-5-4-6-12-10(11)7-8-21-12/h7-8,11H,3-6,16H2,1-2H3,(H2,17,18,19,20) |
| InChIKey | ZFPUMDBCWNTKDP-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.44 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|