C12H16N6S — CID 80919316
6-hydrazinyl-4-N-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)pyrimidine-2,4-diamine (PubChem CID 80919316) has the molecular formula C12H16N6S and a molecular weight of 276.37 g/mol. Its IUPAC name is 6-hydrazinyl-4-N-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)pyrimidine-2,4-diamine.
| Compound Name | 6-hydrazinyl-4-N-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80919316 |
| Molecular Formula | C12H16N6S |
| Molecular Weight | 276.37 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 6-hydrazinyl-4-N-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)pyrimidine-2,4-diamine |
| SMILES | NNc1cc(NC2CCCc3sccc32)nc(N)n1 |
| InChI | InChI=1S/C12H16N6S/c13-12-16-10(6-11(17-12)18-14)15-8-2-1-3-9-7(8)4-5-19-9/h4-6,8H,1-3,14H2,(H4,13,15,16,17,18) |
| InChIKey | QVEQJHNNLKTUJC-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 101.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.37 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|