C11H18N6O2S2 — CID 103333795
N-[1-[(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)amino]-2-methylpropan-2-yl]methanesulfonamide (PubChem CID 103333795) has the molecular formula C11H18N6O2S2 and a molecular weight of 330.44 g/mol. Its IUPAC name is N-[1-[(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)amino]-2-methylpropan-2-yl]methanesulfonamide.
| Compound Name | N-[1-[(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)amino]-2-methylpropan-2-yl]methanesulfonamide |
|---|---|
| PubChem CID | 103333795 |
| Molecular Formula | C11H18N6O2S2 |
| Molecular Weight | 330.44 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | N-[1-[(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)amino]-2-methylpropan-2-yl]methanesulfonamide |
| SMILES | CC(C)(CNc1nc(NN)nc2sccc12)NS(C)(=O)=O |
| InChI | InChI=1S/C11H18N6O2S2/c1-11(2,17-21(3,18)19)6-13-8-7-4-5-20-9(7)15-10(14-8)16-12/h4-5,17H,6,12H2,1-3H3,(H2,13,14,15,16) |
| InChIKey | BUUOOGHWZLDGDV-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 122.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.44 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|