C11H16N4OS — CID 106846941
4-[[2-(methylamino)thieno[2,3-d]pyrimidin-4-yl]amino]butan-1-ol (PubChem CID 106846941) has the molecular formula C11H16N4OS and a molecular weight of 252.34 g/mol. Its IUPAC name is 4-[[2-(methylamino)thieno[2,3-d]pyrimidin-4-yl]amino]butan-1-ol.
| Compound Name | 4-[[2-(methylamino)thieno[2,3-d]pyrimidin-4-yl]amino]butan-1-ol |
|---|---|
| PubChem CID | 106846941 |
| Molecular Formula | C11H16N4OS |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 4-[[2-(methylamino)thieno[2,3-d]pyrimidin-4-yl]amino]butan-1-ol |
| SMILES | CNc1nc(NCCCCO)c2ccsc2n1 |
| InChI | InChI=1S/C11H16N4OS/c1-12-11-14-9(13-5-2-3-6-16)8-4-7-17-10(8)15-11/h4,7,16H,2-3,5-6H2,1H3,(H2,12,13,14,15) |
| InChIKey | VUSFPPHZYCZYQT-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|