C14H11N3O2S — CID 2453988
methyl 4-(thieno[2,3-d]pyrimidin-4-ylamino)benzoate (PubChem CID 2453988) has the molecular formula C14H11N3O2S and a molecular weight of 285.33 g/mol. Its IUPAC name is methyl 4-(thieno[2,3-d]pyrimidin-4-ylamino)benzoate.
| Compound Name | methyl 4-(thieno[2,3-d]pyrimidin-4-ylamino)benzoate |
|---|---|
| PubChem CID | 2453988 |
| Molecular Formula | C14H11N3O2S |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | methyl 4-(thieno[2,3-d]pyrimidin-4-ylamino)benzoate |
| SMILES | COC(=O)c1ccc(Nc2ncnc3sccc23)cc1 |
| InChI | InChI=1S/C14H11N3O2S/c1-19-14(18)9-2-4-10(5-3-9)17-12-11-6-7-20-13(11)16-8-15-12/h2-8H,1H3,(H,15,16,17) |
| InChIKey | OEVAGSFZEOUFHT-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |