methyl 4-(thieno[2,3-d]pyrimidin-4-ylamino)benzoate

C14H11N3O2S — CID 2453988

IUPACmethyl 4-(thieno[2,3-d]pyrimidin-4-ylamino)benzoate
SMILESCOC(=O)c1ccc(Nc2ncnc3sccc23)cc1
InChIInChI=1S/C14H11N3O2S/c1-19-14(18)9-2-4-10(5-3-9)17-12-11-6-7-20-13(11)16-8-15-12/h2-8H,1H3,(H,15,16,17)
InChIKeyOEVAGSFZEOUFHT-UHFFFAOYSA-N
MW285.33 g/mol
LogP3.22
Rot. Bonds3

About methyl 4-(thieno[2,3-d]pyrimidin-4-ylamino)benzoate

methyl 4-(thieno[2,3-d]pyrimidin-4-ylamino)benzoate (PubChem CID 2453988) has the molecular formula C14H11N3O2S and a molecular weight of 285.33 g/mol. Its IUPAC name is methyl 4-(thieno[2,3-d]pyrimidin-4-ylamino)benzoate.

Molecular Properties

Compound Namemethyl 4-(thieno[2,3-d]pyrimidin-4-ylamino)benzoate
PubChem CID2453988
Molecular FormulaC14H11N3O2S
Molecular Weight285.33 g/mol
Exact Mass285.06
IUPAC Namemethyl 4-(thieno[2,3-d]pyrimidin-4-ylamino)benzoate
SMILESCOC(=O)c1ccc(Nc2ncnc3sccc23)cc1
InChIInChI=1S/C14H11N3O2S/c1-19-14(18)9-2-4-10(5-3-9)17-12-11-6-7-20-13(11)16-8-15-12/h2-8H,1H3,(H,15,16,17)
InChIKeyOEVAGSFZEOUFHT-UHFFFAOYSA-N
XLogP3.22
TPSA64.11 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500285.33
LogP ≤ 53.22
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Analyze methyl 4-(thieno[2,3-d]pyrimidin-4-ylamino)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-(thieno[2,3-d]pyrimidin-4-ylamino)benzoate?
The IUPAC name of methyl 4-(thieno[2,3-d]pyrimidin-4-ylamino)benzoate (CID 2453988) is methyl 4-(thieno[2,3-d]pyrimidin-4-ylamino)benzoate.
What is the SMILES notation for methyl 4-(thieno[2,3-d]pyrimidin-4-ylamino)benzoate?
The canonical SMILES for methyl 4-(thieno[2,3-d]pyrimidin-4-ylamino)benzoate is COC(=O)c1ccc(Nc2ncnc3sccc23)cc1.
What is the InChIKey of methyl 4-(thieno[2,3-d]pyrimidin-4-ylamino)benzoate?
The InChIKey is OEVAGSFZEOUFHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N3O2S/c1-19-14(18)9-2-4-10(5-3-9)17-12-11-6-7-20-13(11)16-8-15-12/h2-8H,1H3,(H,15,16,17).
What are the key properties of methyl 4-(thieno[2,3-d]pyrimidin-4-ylamino)benzoate?
methyl 4-(thieno[2,3-d]pyrimidin-4-ylamino)benzoate has a molecular weight of 285.33 g/mol, XLogP of 3.22, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(thieno[2,3-d]pyrimidin-4-ylamino)benzoate is sourced from PubChem (CID 2453988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).