About ethyl N-[2-methyl-4-(thieno[2,3-d]pyrimidin-4-ylamino)phenyl]carbamate
ethyl N-[2-methyl-4-(thieno[2,3-d]pyrimidin-4-ylamino)phenyl]carbamate (PubChem CID 122193760) has the molecular formula C16H16N4O2S
and a molecular weight of 328.40 g/mol. Its IUPAC name is ethyl N-[2-methyl-4-(thieno[2,3-d]pyrimidin-4-ylamino)phenyl]carbamate.
Molecular Properties
| Compound Name | ethyl N-[2-methyl-4-(thieno[2,3-d]pyrimidin-4-ylamino)phenyl]carbamate |
| PubChem CID | 122193760 |
| Molecular Formula | C16H16N4O2S |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | ethyl N-[2-methyl-4-(thieno[2,3-d]pyrimidin-4-ylamino)phenyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(Nc2ncnc3sccc23)cc1C |
| InChI | InChI=1S/C16H16N4O2S/c1-3-22-16(21)20-13-5-4-11(8-10(13)2)19-14-12-6-7-23-15(12)18-9-17-14/h4-9H,3H2,1-2H3,(H,20,21)(H,17,18,19) |
| InChIKey | ZIKVLGJYVJWPSD-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl N-[2-methyl-4-(thieno[2,3-d]pyrimidin-4-ylamino)phenyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[2-methyl-4-(thieno[2,3-d]pyrimidin-4-ylamino)phenyl]carbamate?
The IUPAC name of ethyl N-[2-methyl-4-(thieno[2,3-d]pyrimidin-4-ylamino)phenyl]carbamate (CID 122193760) is ethyl N-[2-methyl-4-(thieno[2,3-d]pyrimidin-4-ylamino)phenyl]carbamate.
What is the SMILES notation for ethyl N-[2-methyl-4-(thieno[2,3-d]pyrimidin-4-ylamino)phenyl]carbamate?
The canonical SMILES for ethyl N-[2-methyl-4-(thieno[2,3-d]pyrimidin-4-ylamino)phenyl]carbamate is CCOC(=O)Nc1ccc(Nc2ncnc3sccc23)cc1C.
What is the InChIKey of ethyl N-[2-methyl-4-(thieno[2,3-d]pyrimidin-4-ylamino)phenyl]carbamate?
The InChIKey is ZIKVLGJYVJWPSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N4O2S/c1-3-22-16(21)20-13-5-4-11(8-10(13)2)19-14-12-6-7-23-15(12)18-9-17-14/h4-9H,3H2,1-2H3,(H,20,21)(H,17,18,19).
What are the key properties of ethyl N-[2-methyl-4-(thieno[2,3-d]pyrimidin-4-ylamino)phenyl]carbamate?
ethyl N-[2-methyl-4-(thieno[2,3-d]pyrimidin-4-ylamino)phenyl]carbamate has a molecular weight of 328.40 g/mol, XLogP of 4.31, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[2-methyl-4-(thieno[2,3-d]pyrimidin-4-ylamino)phenyl]carbamate is sourced from PubChem (CID 122193760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).