C18H20N4S — CID 36725383
N-[(1R)-1-phenyl-2-pyrrolidin-1-ylethyl]thieno[2,3-d]pyrimidin-4-amine (PubChem CID 36725383) has the molecular formula C18H20N4S and a molecular weight of 324.45 g/mol. Its IUPAC name is N-[(1R)-1-phenyl-2-pyrrolidin-1-ylethyl]thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[(1R)-1-phenyl-2-pyrrolidin-1-ylethyl]thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 36725383 |
| Molecular Formula | C18H20N4S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | N-[(1R)-1-phenyl-2-pyrrolidin-1-ylethyl]thieno[2,3-d]pyrimidin-4-amine |
| SMILES | c1ccc([C@H](CN2CCCC2)Nc2ncnc3sccc23)cc1 |
| InChI | InChI=1S/C18H20N4S/c1-2-6-14(7-3-1)16(12-22-9-4-5-10-22)21-17-15-8-11-23-18(15)20-13-19-17/h1-3,6-8,11,13,16H,4-5,9-10,12H2,(H,19,20,21)/t16-/m0/s1 |
| InChIKey | VBQHWKWTNZGUER-INIZCTEOSA-N |
| XLogP | 3.94 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |