C17H18N4S — CID 17430718
N-[4-(pyrrolidin-1-ylmethyl)phenyl]thieno[2,3-d]pyrimidin-4-amine (PubChem CID 17430718) has the molecular formula C17H18N4S and a molecular weight of 310.43 g/mol. Its IUPAC name is N-[4-(pyrrolidin-1-ylmethyl)phenyl]thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[4-(pyrrolidin-1-ylmethyl)phenyl]thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 17430718 |
| Molecular Formula | C17H18N4S |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | N-[4-(pyrrolidin-1-ylmethyl)phenyl]thieno[2,3-d]pyrimidin-4-amine |
| SMILES | c1nc(Nc2ccc(CN3CCCC3)cc2)c2ccsc2n1 |
| InChI | InChI=1S/C17H18N4S/c1-2-9-21(8-1)11-13-3-5-14(6-4-13)20-16-15-7-10-22-17(15)19-12-18-16/h3-7,10,12H,1-2,8-9,11H2,(H,18,19,20) |
| InChIKey | YCUBYOWLUDLZKY-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |