C16H10N4O3S — CID 7615382
2-(1,3-dioxoisoindol-2-yl)-N-thieno[2,3-d]pyrimidin-4-ylacetamide (PubChem CID 7615382) has the molecular formula C16H10N4O3S and a molecular weight of 338.35 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-thieno[2,3-d]pyrimidin-4-ylacetamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-thieno[2,3-d]pyrimidin-4-ylacetamide |
|---|---|
| PubChem CID | 7615382 |
| Molecular Formula | C16H10N4O3S |
| Molecular Weight | 338.35 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-thieno[2,3-d]pyrimidin-4-ylacetamide |
| SMILES | O=C(CN1C(=O)c2ccccc2C1=O)Nc1ncnc2sccc12 |
| InChI | InChI=1S/C16H10N4O3S/c21-12(19-13-11-5-6-24-14(11)18-8-17-13)7-20-15(22)9-3-1-2-4-10(9)16(20)23/h1-6,8H,7H2,(H,17,18,19,21) |
| InChIKey | OTHLNCSMGMXIGK-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.35 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|