C16H17N5 — CID 133286334
N-[cyclobutyl(phenyl)methyl]-1H-pyrazolo[5,4-d]pyrimidin-4-amine (PubChem CID 133286334) has the molecular formula C16H17N5 and a molecular weight of 279.35 g/mol. Its IUPAC name is N-[cyclobutyl(phenyl)methyl]-1H-pyrazolo[5,4-d]pyrimidin-4-amine.
| Compound Name | N-[cyclobutyl(phenyl)methyl]-1H-pyrazolo[5,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 133286334 |
| Molecular Formula | C16H17N5 |
| Molecular Weight | 279.35 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | N-[cyclobutyl(phenyl)methyl]-1H-pyrazolo[5,4-d]pyrimidin-4-amine |
| SMILES | c1ccc(C(Nc2ncnc3[nH]ncc23)C2CCC2)cc1 |
| InChI | InChI=1S/C16H17N5/c1-2-5-11(6-3-1)14(12-7-4-8-12)20-15-13-9-19-21-16(13)18-10-17-15/h1-3,5-6,9-10,12,14H,4,7-8H2,(H2,17,18,19,20,21) |
| InChIKey | RQNBMKIRFJBFSP-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.35 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |