C12H18FN3O — CID 62734354
N,N-diethyl-3-[(3-fluoro-2-pyridinyl)amino]propanamide (PubChem CID 62734354) has the molecular formula C12H18FN3O and a molecular weight of 239.29 g/mol. Its IUPAC name is N,N-diethyl-3-[(3-fluoro-2-pyridinyl)amino]propanamide.
| Compound Name | N,N-diethyl-3-[(3-fluoro-2-pyridinyl)amino]propanamide |
|---|---|
| PubChem CID | 62734354 |
| Molecular Formula | C12H18FN3O |
| Molecular Weight | 239.29 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | N,N-diethyl-3-[(3-fluoro-2-pyridinyl)amino]propanamide |
| SMILES | CCN(CC)C(=O)CCNc1ncccc1F |
| InChI | InChI=1S/C12H18FN3O/c1-3-16(4-2)11(17)7-9-15-12-10(13)6-5-8-14-12/h5-6,8H,3-4,7,9H2,1-2H3,(H,14,15) |
| InChIKey | MAPTZGCZGQLWEG-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.29 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |