C15H16N4O — CID 103736415
3-[(3-cyanoquinolin-2-yl)amino]-2,2-dimethylpropanamide (PubChem CID 103736415) has the molecular formula C15H16N4O and a molecular weight of 268.32 g/mol. Its IUPAC name is 3-[(3-cyanoquinolin-2-yl)amino]-2,2-dimethylpropanamide.
| Compound Name | 3-[(3-cyanoquinolin-2-yl)amino]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 103736415 |
| Molecular Formula | C15H16N4O |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 3-[(3-cyanoquinolin-2-yl)amino]-2,2-dimethylpropanamide |
| SMILES | CC(C)(CNc1nc2ccccc2cc1C#N)C(N)=O |
| InChI | InChI=1S/C15H16N4O/c1-15(2,14(17)20)9-18-13-11(8-16)7-10-5-3-4-6-12(10)19-13/h3-7H,9H2,1-2H3,(H2,17,20)(H,18,19) |
| InChIKey | KWKCKVXIEOWISY-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |