C16H18N4O — CID 79834245
N-tert-butyl-2-[(3-cyanoquinolin-2-yl)amino]acetamide (PubChem CID 79834245) has the molecular formula C16H18N4O and a molecular weight of 282.35 g/mol. Its IUPAC name is N-tert-butyl-2-[(3-cyanoquinolin-2-yl)amino]acetamide.
| Compound Name | N-tert-butyl-2-[(3-cyanoquinolin-2-yl)amino]acetamide |
|---|---|
| PubChem CID | 79834245 |
| Molecular Formula | C16H18N4O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | N-tert-butyl-2-[(3-cyanoquinolin-2-yl)amino]acetamide |
| SMILES | CC(C)(C)NC(=O)CNc1nc2ccccc2cc1C#N |
| InChI | InChI=1S/C16H18N4O/c1-16(2,3)20-14(21)10-18-15-12(9-17)8-11-6-4-5-7-13(11)19-15/h4-8H,10H2,1-3H3,(H,18,19)(H,20,21) |
| InChIKey | BANBZPGRJHRVMP-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |