C12H12F2N2O — CID 104858613
2,2-difluoro-3-(quinolin-2-ylamino)propan-1-ol (PubChem CID 104858613) has the molecular formula C12H12F2N2O and a molecular weight of 238.24 g/mol. Its IUPAC name is 2,2-difluoro-3-(quinolin-2-ylamino)propan-1-ol.
| Compound Name | 2,2-difluoro-3-(quinolin-2-ylamino)propan-1-ol |
|---|---|
| PubChem CID | 104858613 |
| Molecular Formula | C12H12F2N2O |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 2,2-difluoro-3-(quinolin-2-ylamino)propan-1-ol |
| SMILES | OCC(F)(F)CNc1ccc2ccccc2n1 |
| InChI | InChI=1S/C12H12F2N2O/c13-12(14,8-17)7-15-11-6-5-9-3-1-2-4-10(9)16-11/h1-6,17H,7-8H2,(H,15,16) |
| InChIKey | QSKHAIWAUNQIQF-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |