C13H14F2N4O — CID 106179314
3-[(6-amino-2-phenylpyrimidin-4-yl)amino]-2,2-difluoropropan-1-ol (PubChem CID 106179314) has the molecular formula C13H14F2N4O and a molecular weight of 280.28 g/mol. Its IUPAC name is 3-[(6-amino-2-phenylpyrimidin-4-yl)amino]-2,2-difluoropropan-1-ol.
| Compound Name | 3-[(6-amino-2-phenylpyrimidin-4-yl)amino]-2,2-difluoropropan-1-ol |
|---|---|
| PubChem CID | 106179314 |
| Molecular Formula | C13H14F2N4O |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 3-[(6-amino-2-phenylpyrimidin-4-yl)amino]-2,2-difluoropropan-1-ol |
| SMILES | Nc1cc(NCC(F)(F)CO)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C13H14F2N4O/c14-13(15,8-20)7-17-11-6-10(16)18-12(19-11)9-4-2-1-3-5-9/h1-6,20H,7-8H2,(H3,16,17,18,19) |
| InChIKey | ZKJHVBQIHLSFNO-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |