C14H22IN5 — CID 111033686
2-[2-(1H-benzimidazol-2-yl)ethyl]-1-tert-butylguanidine;hydroiodide (PubChem CID 111033686) has the molecular formula C14H22IN5 and a molecular weight of 387.27 g/mol. Its IUPAC name is 2-[2-(1H-benzimidazol-2-yl)ethyl]-1-tert-butylguanidine;hydroiodide.
| Compound Name | 2-[2-(1H-benzimidazol-2-yl)ethyl]-1-tert-butylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111033686 |
| Molecular Formula | C14H22IN5 |
| Molecular Weight | 387.27 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 2-[2-(1H-benzimidazol-2-yl)ethyl]-1-tert-butylguanidine;hydroiodide |
| SMILES | CC(C)(C)N/C(N)=N/CCc1nc2ccccc2[nH]1.I |
| InChI | InChI=1S/C14H21N5.HI/c1-14(2,3)19-13(15)16-9-8-12-17-10-6-4-5-7-11(10)18-12;/h4-7H,8-9H2,1-3H3,(H,17,18)(H3,15,16,19);1H |
| InChIKey | VGEHXBVEVLEJCA-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 79.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.27 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|