C11H16Cl2N4S — CID 131875532
N'-[2-(1H-benzimidazol-2-yl)ethyl]-2-sulfanylethanimidamide;dihydrochloride (PubChem CID 131875532) has the molecular formula C11H16Cl2N4S and a molecular weight of 307.25 g/mol. Its IUPAC name is N'-[2-(1H-benzimidazol-2-yl)ethyl]-2-sulfanylethanimidamide;dihydrochloride.
| Compound Name | N'-[2-(1H-benzimidazol-2-yl)ethyl]-2-sulfanylethanimidamide;dihydrochloride |
|---|---|
| PubChem CID | 131875532 |
| Molecular Formula | C11H16Cl2N4S |
| Molecular Weight | 307.25 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | N'-[2-(1H-benzimidazol-2-yl)ethyl]-2-sulfanylethanimidamide;dihydrochloride |
| SMILES | Cl.Cl.N/C(CS)=N/CCc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C11H14N4S.2ClH/c12-10(7-16)13-6-5-11-14-8-3-1-2-4-9(8)15-11;;/h1-4,16H,5-7H2,(H2,12,13)(H,14,15);2*1H |
| InChIKey | AWLHNKWVBNOQKE-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 67.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.25 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|