C18H22IN5 — CID 111033680
2-[2-(1H-benzimidazol-2-yl)ethyl]-1-(3,5-dimethylphenyl)guanidine;hydroiodide (PubChem CID 111033680) has the molecular formula C18H22IN5 and a molecular weight of 435.31 g/mol. Its IUPAC name is 2-[2-(1H-benzimidazol-2-yl)ethyl]-1-(3,5-dimethylphenyl)guanidine;hydroiodide.
| Compound Name | 2-[2-(1H-benzimidazol-2-yl)ethyl]-1-(3,5-dimethylphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111033680 |
| Molecular Formula | C18H22IN5 |
| Molecular Weight | 435.31 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | 2-[2-(1H-benzimidazol-2-yl)ethyl]-1-(3,5-dimethylphenyl)guanidine;hydroiodide |
| SMILES | Cc1cc(C)cc(N/C(N)=N/CCc2nc3ccccc3[nH]2)c1.I |
| InChI | InChI=1S/C18H21N5.HI/c1-12-9-13(2)11-14(10-12)21-18(19)20-8-7-17-22-15-5-3-4-6-16(15)23-17;/h3-6,9-11H,7-8H2,1-2H3,(H,22,23)(H3,19,20,21);1H |
| InChIKey | ULOAWPXZASSOEY-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 79.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.31 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|