C19H30IN5O — CID 111605332
1-ethyl-2-(2-methoxy-2-methylpropyl)-3-[2-(quinolin-2-ylamino)ethyl]guanidine;hydroiodide (PubChem CID 111605332) has the molecular formula C19H30IN5O and a molecular weight of 471.39 g/mol. Its IUPAC name is 1-ethyl-2-(2-methoxy-2-methylpropyl)-3-[2-(quinolin-2-ylamino)ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-(2-methoxy-2-methylpropyl)-3-[2-(quinolin-2-ylamino)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111605332 |
| Molecular Formula | C19H30IN5O |
| Molecular Weight | 471.39 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | 1-ethyl-2-(2-methoxy-2-methylpropyl)-3-[2-(quinolin-2-ylamino)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(C)OC)NCCNc1ccc2ccccc2n1.I |
| InChI | InChI=1S/C19H29N5O.HI/c1-5-20-18(23-14-19(2,3)25-4)22-13-12-21-17-11-10-15-8-6-7-9-16(15)24-17;/h6-11H,5,12-14H2,1-4H3,(H,21,24)(H2,20,22,23);1H |
| InChIKey | NAKYZDLIVFOVBV-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 70.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.39 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|