C13H20N2O2 — CID 158537293
6-methoxy-N-(5-methyl-2-pyridinyl)hexanamide (PubChem CID 158537293) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is 6-methoxy-N-(5-methyl-2-pyridinyl)hexanamide.
| Compound Name | 6-methoxy-N-(5-methyl-2-pyridinyl)hexanamide |
|---|---|
| PubChem CID | 158537293 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | 6-methoxy-N-(5-methyl-2-pyridinyl)hexanamide |
| SMILES | COCCCCCC(=O)Nc1ccc(C)cn1 |
| InChI | InChI=1S/C13H20N2O2/c1-11-7-8-12(14-10-11)15-13(16)6-4-3-5-9-17-2/h7-8,10H,3-6,9H2,1-2H3,(H,14,15,16) |
| InChIKey | QBEBEGCPRWPPFU-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|