C18H20F3N2O+ — CID 8517438
methyl-[(4-methylphenyl)methyl]-[(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl]azanium (PubChem CID 8517438) has the molecular formula C18H20F3N2O+ and a molecular weight of 337.37 g/mol. Its IUPAC name is methyl-[(4-methylphenyl)methyl]-[(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl]azanium.
| Compound Name | methyl-[(4-methylphenyl)methyl]-[(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl]azanium |
|---|---|
| PubChem CID | 8517438 |
| Molecular Formula | C18H20F3N2O+ |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | methyl-[(4-methylphenyl)methyl]-[(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl]azanium |
| SMILES | Cc1ccc(C[NH+](C)[C@@H](C)C(=O)Nc2ccc(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C18H19F3N2O/c1-11-4-6-13(7-5-11)10-23(3)12(2)18(24)22-15-9-8-14(19)16(20)17(15)21/h4-9,12H,10H2,1-3H3,(H,22,24)/p+1/t12-/m0/s1 |
| InChIKey | CYCIBANQYUMDBA-LBPRGKRZSA-O |
| XLogP | 2.45 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|