C21H28FN2O+ — CID 8516007
(4-tert-butylphenyl)methyl-[(2R)-1-(2-fluoroanilino)-1-oxopropan-2-yl]-methylazanium (PubChem CID 8516007) has the molecular formula C21H28FN2O+ and a molecular weight of 343.47 g/mol. Its IUPAC name is (4-tert-butylphenyl)methyl-[(2R)-1-(2-fluoroanilino)-1-oxopropan-2-yl]-methylazanium.
| Compound Name | (4-tert-butylphenyl)methyl-[(2R)-1-(2-fluoroanilino)-1-oxopropan-2-yl]-methylazanium |
|---|---|
| PubChem CID | 8516007 |
| Molecular Formula | C21H28FN2O+ |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.22 |
| IUPAC Name | (4-tert-butylphenyl)methyl-[(2R)-1-(2-fluoroanilino)-1-oxopropan-2-yl]-methylazanium |
| SMILES | C[C@H](C(=O)Nc1ccccc1F)[NH+](C)Cc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H27FN2O/c1-15(20(25)23-19-9-7-6-8-18(19)22)24(5)14-16-10-12-17(13-11-16)21(2,3)4/h6-13,15H,14H2,1-5H3,(H,23,25)/p+1/t15-/m1/s1 |
| InChIKey | VUWLDCVHYBDQEJ-OAHLLOKOSA-O |
| XLogP | 3.17 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |