C19H24FN2O+ — CID 8517771
[(2R)-1-(4-ethylanilino)-1-oxopropan-2-yl]-[(2-fluorophenyl)methyl]-methylazanium (PubChem CID 8517771) has the molecular formula C19H24FN2O+ and a molecular weight of 315.41 g/mol. Its IUPAC name is [(2R)-1-(4-ethylanilino)-1-oxopropan-2-yl]-[(2-fluorophenyl)methyl]-methylazanium.
| Compound Name | [(2R)-1-(4-ethylanilino)-1-oxopropan-2-yl]-[(2-fluorophenyl)methyl]-methylazanium |
|---|---|
| PubChem CID | 8517771 |
| Molecular Formula | C19H24FN2O+ |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | [(2R)-1-(4-ethylanilino)-1-oxopropan-2-yl]-[(2-fluorophenyl)methyl]-methylazanium |
| SMILES | CCc1ccc(NC(=O)[C@@H](C)[NH+](C)Cc2ccccc2F)cc1 |
| InChI | InChI=1S/C19H23FN2O/c1-4-15-9-11-17(12-10-15)21-19(23)14(2)22(3)13-16-7-5-6-8-18(16)20/h5-12,14H,4,13H2,1-3H3,(H,21,23)/p+1/t14-/m1/s1 |
| InChIKey | AOLULWMVLWRHGM-CQSZACIVSA-O |
| XLogP | 2.43 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |