C17H19F2N2O+ — CID 8517814
[(2S)-1-(2-fluoroanilino)-1-oxopropan-2-yl]-[(2-fluorophenyl)methyl]-methylazanium (PubChem CID 8517814) has the molecular formula C17H19F2N2O+ and a molecular weight of 305.35 g/mol. Its IUPAC name is [(2S)-1-(2-fluoroanilino)-1-oxopropan-2-yl]-[(2-fluorophenyl)methyl]-methylazanium.
| Compound Name | [(2S)-1-(2-fluoroanilino)-1-oxopropan-2-yl]-[(2-fluorophenyl)methyl]-methylazanium |
|---|---|
| PubChem CID | 8517814 |
| Molecular Formula | C17H19F2N2O+ |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | [(2S)-1-(2-fluoroanilino)-1-oxopropan-2-yl]-[(2-fluorophenyl)methyl]-methylazanium |
| SMILES | C[C@@H](C(=O)Nc1ccccc1F)[NH+](C)Cc1ccccc1F |
| InChI | InChI=1S/C17H18F2N2O/c1-12(17(22)20-16-10-6-5-9-15(16)19)21(2)11-13-7-3-4-8-14(13)18/h3-10,12H,11H2,1-2H3,(H,20,22)/p+1/t12-/m0/s1 |
| InChIKey | YSFSEIPQZACWNA-LBPRGKRZSA-O |
| XLogP | 2.01 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |