C18H19BrF3N2O2+ — CID 2438618
(5-bromo-2-methoxyphenyl)methyl-methyl-[(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl]azanium (PubChem CID 2438618) has the molecular formula C18H19BrF3N2O2+ and a molecular weight of 432.26 g/mol. Its IUPAC name is (5-bromo-2-methoxyphenyl)methyl-methyl-[(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl]azanium.
| Compound Name | (5-bromo-2-methoxyphenyl)methyl-methyl-[(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl]azanium |
|---|---|
| PubChem CID | 2438618 |
| Molecular Formula | C18H19BrF3N2O2+ |
| Molecular Weight | 432.26 g/mol |
| Exact Mass | 431.06 |
| IUPAC Name | (5-bromo-2-methoxyphenyl)methyl-methyl-[(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl]azanium |
| SMILES | COc1ccc(Br)cc1C[NH+](C)[C@@H](C)C(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C18H18BrF3N2O2/c1-10(18(25)23-14-6-5-13(20)16(21)17(14)22)24(2)9-11-8-12(19)4-7-15(11)26-3/h4-8,10H,9H2,1-3H3,(H,23,25)/p+1/t10-/m0/s1 |
| InChIKey | ALQRZMREDNMMNZ-JTQLQIEISA-O |
| XLogP | 2.92 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.26 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|