C16H18F3N2OS+ — CID 9265037
methyl-[(3-methylthiophen-2-yl)methyl]-[(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl]azanium (PubChem CID 9265037) has the molecular formula C16H18F3N2OS+ and a molecular weight of 343.39 g/mol. Its IUPAC name is methyl-[(3-methylthiophen-2-yl)methyl]-[(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl]azanium.
| Compound Name | methyl-[(3-methylthiophen-2-yl)methyl]-[(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl]azanium |
|---|---|
| PubChem CID | 9265037 |
| Molecular Formula | C16H18F3N2OS+ |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | methyl-[(3-methylthiophen-2-yl)methyl]-[(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl]azanium |
| SMILES | Cc1ccsc1C[NH+](C)[C@H](C)C(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C16H17F3N2OS/c1-9-6-7-23-13(9)8-21(3)10(2)16(22)20-12-5-4-11(17)14(18)15(12)19/h4-7,10H,8H2,1-3H3,(H,20,22)/p+1/t10-/m1/s1 |
| InChIKey | CXRKKPZLWOQAII-SNVBAGLBSA-O |
| XLogP | 2.52 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|